C58H86O12 — CID 87150790
bis(3,4-dibutylphthalic acid);3,4-di(nonyl)phthalic acid (PubChem CID 87150790) has the molecular formula C58H86O12 and a molecular weight of 975.31 g/mol. Its IUPAC name is bis(3,4-dibutylphthalic acid);3,4-di(nonyl)phthalic acid.
| Compound Name | bis(3,4-dibutylphthalic acid);3,4-di(nonyl)phthalic acid |
|---|---|
| PubChem CID | 87150790 |
| Molecular Formula | C58H86O12 |
| Molecular Weight | 975.31 g/mol |
| Exact Mass | 974.61 |
| IUPAC Name | bis(3,4-dibutylphthalic acid);3,4-di(nonyl)phthalic acid |
| SMILES | CCCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCCCCCCC.CCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC.CCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC |
| InChI | InChI=1S/C26H42O4.2C16H22O4/c1-3-5-7-9-11-13-15-17-21-19-20-23(25(27)28)24(26(29)30)22(21)18-16-14-12-10-8-6-4-2;2*1-3-5-7-11-9-10-13(15(17)18)14(16(19)20)12(11)8-6-4-2/h19-20H,3-18H2,1-2H3,(H,27,28)(H,29,30);2*9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | HZBLNSOZVXVWSM-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.31 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|