C20H33OP — CID 175045798
2-phosphanyl-1-(2,3,4-tributylphenyl)ethanone (PubChem CID 175045798) has the molecular formula C20H33OP and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-phosphanyl-1-(2,3,4-tributylphenyl)ethanone.
| Compound Name | 2-phosphanyl-1-(2,3,4-tributylphenyl)ethanone |
|---|---|
| PubChem CID | 175045798 |
| Molecular Formula | C20H33OP |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 2-phosphanyl-1-(2,3,4-tributylphenyl)ethanone |
| SMILES | CCCCc1ccc(C(=O)CP)c(CCCC)c1CCCC |
| InChI | InChI=1S/C20H33OP/c1-4-7-10-16-13-14-19(20(21)15-22)18(12-9-6-3)17(16)11-8-5-2/h13-14H,4-12,15,22H2,1-3H3 |
| InChIKey | CQLIDOAESJIUDC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|