C14H23P — CID 19901991
(2,3-dibutylphenyl)phosphane (PubChem CID 19901991) has the molecular formula C14H23P and a molecular weight of 222.31 g/mol. Its IUPAC name is (2,3-dibutylphenyl)phosphane.
| Compound Name | (2,3-dibutylphenyl)phosphane |
|---|---|
| PubChem CID | 19901991 |
| Molecular Formula | C14H23P |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2,3-dibutylphenyl)phosphane |
| SMILES | CCCCc1cccc(P)c1CCCC |
| InChI | InChI=1S/C14H23P/c1-3-5-8-12-9-7-11-14(15)13(12)10-6-4-2/h7,9,11H,3-6,8,10,15H2,1-2H3 |
| InChIKey | IWQYEANTIFXULT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|