C18H32O — CID 172716323
1,2,3-tributylbenzene;hydrate (PubChem CID 172716323) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 1,2,3-tributylbenzene;hydrate.
| Compound Name | 1,2,3-tributylbenzene;hydrate |
|---|---|
| PubChem CID | 172716323 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1,2,3-tributylbenzene;hydrate |
| SMILES | CCCCc1cccc(CCCC)c1CCCC.O |
| InChI | InChI=1S/C18H30.H2O/c1-4-7-11-16-13-10-14-17(12-8-5-2)18(16)15-9-6-3;/h10,13-14H,4-9,11-12,15H2,1-3H3;1H2 |
| InChIKey | GGOFLYJCRSWWEW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |