C26H40N2O2 — CID 175126140
2-[(9Z,12Z)-octadeca-9,12-dienyl]benzene-1,3-dicarboxamide (PubChem CID 175126140) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 2-[(9Z,12Z)-octadeca-9,12-dienyl]benzene-1,3-dicarboxamide.
| Compound Name | 2-[(9Z,12Z)-octadeca-9,12-dienyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175126140 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 2-[(9Z,12Z)-octadeca-9,12-dienyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCc1c(C(N)=O)cccc1C(N)=O |
| InChI | InChI=1S/C26H40N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-23(25(27)29)20-18-21-24(22)26(28)30/h6-7,9-10,18,20-21H,2-5,8,11-17,19H2,1H3,(H2,27,29)(H2,28,30)/b7-6-,10-9- |
| InChIKey | PZSMNFUHUKDMRZ-HZJYTTRNSA-N |
| XLogP | 6.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|