C20H32N2O2 — CID 140600774
4,6-dihexylbenzene-1,3-dicarboxamide (PubChem CID 140600774) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 4,6-dihexylbenzene-1,3-dicarboxamide.
| Compound Name | 4,6-dihexylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 140600774 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 4,6-dihexylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCCc1cc(CCCCCC)c(C(N)=O)cc1C(N)=O |
| InChI | InChI=1S/C20H32N2O2/c1-3-5-7-9-11-15-13-16(12-10-8-6-4-2)18(20(22)24)14-17(15)19(21)23/h13-14H,3-12H2,1-2H3,(H2,21,23)(H2,22,24) |
| InChIKey | MMQKTDINVRKVHV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|