C11H8ClNO3 — CID 121473408
7-chloro-3,6-dihydroxynaphthalene-2-carboxamide (PubChem CID 121473408) has the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. Its IUPAC name is 7-chloro-3,6-dihydroxynaphthalene-2-carboxamide.
| Compound Name | 7-chloro-3,6-dihydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 121473408 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 7-chloro-3,6-dihydroxynaphthalene-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(Cl)c(O)cc2cc1O |
| InChI | InChI=1S/C11H8ClNO3/c12-8-2-5-1-7(11(13)16)9(14)3-6(5)4-10(8)15/h1-4,14-15H,(H2,13,16) |
| InChIKey | RPRTWUHYYFVWBR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |