C13H8Cl2O5 — CID 101362885
bis(5-chloro-2,4-dihydroxyphenyl)methanone (PubChem CID 101362885) has the molecular formula C13H8Cl2O5 and a molecular weight of 315.11 g/mol. Its IUPAC name is bis(5-chloro-2,4-dihydroxyphenyl)methanone.
| Compound Name | bis(5-chloro-2,4-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 101362885 |
| Molecular Formula | C13H8Cl2O5 |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | bis(5-chloro-2,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(Cl)c(O)cc1O)c1cc(Cl)c(O)cc1O |
| InChI | InChI=1S/C13H8Cl2O5/c14-7-1-5(9(16)3-11(7)18)13(20)6-2-8(15)12(19)4-10(6)17/h1-4,16-19H |
| InChIKey | PQEYXHKVDFWZLP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |