C15H13ClO3 — CID 66701045
1-(5-chloro-2,4-dihydroxyphenyl)-2-(4-methylphenyl)ethanone (PubChem CID 66701045) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dihydroxyphenyl)-2-(4-methylphenyl)ethanone.
| Compound Name | 1-(5-chloro-2,4-dihydroxyphenyl)-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 66701045 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1-(5-chloro-2,4-dihydroxyphenyl)-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2cc(Cl)c(O)cc2O)cc1 |
| InChI | InChI=1S/C15H13ClO3/c1-9-2-4-10(5-3-9)6-13(17)11-7-12(16)15(19)8-14(11)18/h2-5,7-8,18-19H,6H2,1H3 |
| InChIKey | FOSRRKGKMWDIIA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |