C22H19FO3 — CID 91871423
1-[4-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]-2-(4-methylphenyl)ethanone (PubChem CID 91871423) has the molecular formula C22H19FO3 and a molecular weight of 350.39 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[4-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 91871423 |
| Molecular Formula | C22H19FO3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2ccc(OCc3ccc(F)cc3)cc2O)cc1 |
| InChI | InChI=1S/C22H19FO3/c1-15-2-4-16(5-3-15)12-21(24)20-11-10-19(13-22(20)25)26-14-17-6-8-18(23)9-7-17/h2-11,13,25H,12,14H2,1H3 |
| InChIKey | RFFHGCYLXXYBFL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |