C22H20O6S — CID 19106206
2-hydroxy-4-[[4-[(4-methylphenyl)sulfonylmethyl]phenyl]methoxy]benzoic acid (PubChem CID 19106206) has the molecular formula C22H20O6S and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-hydroxy-4-[[4-[(4-methylphenyl)sulfonylmethyl]phenyl]methoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[[4-[(4-methylphenyl)sulfonylmethyl]phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 19106206 |
| Molecular Formula | C22H20O6S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-hydroxy-4-[[4-[(4-methylphenyl)sulfonylmethyl]phenyl]methoxy]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccc(COc3ccc(C(=O)O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C22H20O6S/c1-15-2-9-19(10-3-15)29(26,27)14-17-6-4-16(5-7-17)13-28-18-8-11-20(22(24)25)21(23)12-18/h2-12,23H,13-14H2,1H3,(H,24,25) |
| InChIKey | SGUQAKDLAHLLDL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |