C18H20O6S — CID 19105976
2-hydroxy-4-[4-(4-methylphenyl)sulfonylbutoxy]benzoic acid (PubChem CID 19105976) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-hydroxy-4-[4-(4-methylphenyl)sulfonylbutoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[4-(4-methylphenyl)sulfonylbutoxy]benzoic acid |
|---|---|
| PubChem CID | 19105976 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-hydroxy-4-[4-(4-methylphenyl)sulfonylbutoxy]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)CCCCOc2ccc(C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H20O6S/c1-13-4-7-15(8-5-13)25(22,23)11-3-2-10-24-14-6-9-16(18(20)21)17(19)12-14/h4-9,12,19H,2-3,10-11H2,1H3,(H,20,21) |
| InChIKey | WXIUQRLSNZSFDQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|