C22H18O4 — CID 143547167
4-[[4-(cyclooctatetraenyl)phenyl]methoxy]-2-hydroxybenzoic acid (PubChem CID 143547167) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[[4-(cyclooctatetraenyl)phenyl]methoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[[4-(cyclooctatetraenyl)phenyl]methoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 143547167 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[[4-(cyclooctatetraenyl)phenyl]methoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OCc2ccc(C3=C/C=C\C=C/C=C\3)cc2)cc1O |
| InChI | InChI=1S/C22H18O4/c23-21-14-19(12-13-20(21)22(24)25)26-15-16-8-10-18(11-9-16)17-6-4-2-1-3-5-7-17/h1-14,23H,15H2,(H,24,25)/b2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,17-6+,17-7+ |
| InChIKey | NCHJYDPEQWDJJS-TURNFQLBSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |