C22H16O8 — CID 141018936
4-[[4-(4-carboxyphenoxy)phenyl]methoxy]phthalic acid (PubChem CID 141018936) has the molecular formula C22H16O8 and a molecular weight of 408.36 g/mol. Its IUPAC name is 4-[[4-(4-carboxyphenoxy)phenyl]methoxy]phthalic acid.
| Compound Name | 4-[[4-(4-carboxyphenoxy)phenyl]methoxy]phthalic acid |
|---|---|
| PubChem CID | 141018936 |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[[4-(4-carboxyphenoxy)phenyl]methoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(COc3ccc(C(=O)O)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C22H16O8/c23-20(24)14-3-7-16(8-4-14)30-15-5-1-13(2-6-15)12-29-17-9-10-18(21(25)26)19(11-17)22(27)28/h1-11H,12H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | FIPATYFOZGIIOP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |