About ethane;4-phenylmethoxyphthalic acid
ethane;4-phenylmethoxyphthalic acid (PubChem CID 90802135) has the molecular formula C17H18O5
and a molecular weight of 302.33 g/mol. Its IUPAC name is ethane;4-phenylmethoxyphthalic acid.
Molecular Properties
| Compound Name | ethane;4-phenylmethoxyphthalic acid |
| PubChem CID | 90802135 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | ethane;4-phenylmethoxyphthalic acid |
| SMILES | CC.O=C(O)c1ccc(OCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C15H12O5.C2H6/c16-14(17)12-7-6-11(8-13(12)15(18)19)20-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2,(H,16,17)(H,18,19);1-2H3 |
| InChIKey | PXRDCKXNOVGUHR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-phenylmethoxyphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-phenylmethoxyphthalic acid?
The IUPAC name of ethane;4-phenylmethoxyphthalic acid (CID 90802135) is ethane;4-phenylmethoxyphthalic acid.
What is the SMILES notation for ethane;4-phenylmethoxyphthalic acid?
The canonical SMILES for ethane;4-phenylmethoxyphthalic acid is CC.O=C(O)c1ccc(OCc2ccccc2)cc1C(=O)O.
What is the InChIKey of ethane;4-phenylmethoxyphthalic acid?
The InChIKey is PXRDCKXNOVGUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5.C2H6/c16-14(17)12-7-6-11(8-13(12)15(18)19)20-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2,(H,16,17)(H,18,19);1-2H3.
What are the key properties of ethane;4-phenylmethoxyphthalic acid?
ethane;4-phenylmethoxyphthalic acid has a molecular weight of 302.33 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-phenylmethoxyphthalic acid is sourced from PubChem (CID 90802135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).