ethane;4-phenylmethoxyphthalic acid

C17H18O5 — CID 90802135

IUPACethane;4-phenylmethoxyphthalic acid
SMILESCC.O=C(O)c1ccc(OCc2ccccc2)cc1C(=O)O
InChIInChI=1S/C15H12O5.C2H6/c16-14(17)12-7-6-11(8-13(12)15(18)19)20-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2,(H,16,17)(H,18,19);1-2H3
InChIKeyPXRDCKXNOVGUHR-UHFFFAOYSA-N
MW302.33 g/mol
LogP3.69
Rot. Bonds5

About ethane;4-phenylmethoxyphthalic acid

ethane;4-phenylmethoxyphthalic acid (PubChem CID 90802135) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethane;4-phenylmethoxyphthalic acid.

Molecular Properties

Compound Nameethane;4-phenylmethoxyphthalic acid
PubChem CID90802135
Molecular FormulaC17H18O5
Molecular Weight302.33 g/mol
Exact Mass302.12
IUPAC Nameethane;4-phenylmethoxyphthalic acid
SMILESCC.O=C(O)c1ccc(OCc2ccccc2)cc1C(=O)O
InChIInChI=1S/C15H12O5.C2H6/c16-14(17)12-7-6-11(8-13(12)15(18)19)20-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2,(H,16,17)(H,18,19);1-2H3
InChIKeyPXRDCKXNOVGUHR-UHFFFAOYSA-N
XLogP3.69
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.33
LogP ≤ 53.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze ethane;4-phenylmethoxyphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;4-phenylmethoxyphthalic acid?
The IUPAC name of ethane;4-phenylmethoxyphthalic acid (CID 90802135) is ethane;4-phenylmethoxyphthalic acid.
What is the SMILES notation for ethane;4-phenylmethoxyphthalic acid?
The canonical SMILES for ethane;4-phenylmethoxyphthalic acid is CC.O=C(O)c1ccc(OCc2ccccc2)cc1C(=O)O.
What is the InChIKey of ethane;4-phenylmethoxyphthalic acid?
The InChIKey is PXRDCKXNOVGUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5.C2H6/c16-14(17)12-7-6-11(8-13(12)15(18)19)20-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2,(H,16,17)(H,18,19);1-2H3.
What are the key properties of ethane;4-phenylmethoxyphthalic acid?
ethane;4-phenylmethoxyphthalic acid has a molecular weight of 302.33 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-phenylmethoxyphthalic acid is sourced from PubChem (CID 90802135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).