C31H30O6 — CID 159295589
methyl 2-methyl-4-phenylmethoxybenzoate;2-methyl-4-phenylmethoxybenzoic acid (PubChem CID 159295589) has the molecular formula C31H30O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 2-methyl-4-phenylmethoxybenzoate;2-methyl-4-phenylmethoxybenzoic acid.
| Compound Name | methyl 2-methyl-4-phenylmethoxybenzoate;2-methyl-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 159295589 |
| Molecular Formula | C31H30O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | methyl 2-methyl-4-phenylmethoxybenzoate;2-methyl-4-phenylmethoxybenzoic acid |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)cc1C.Cc1cc(OCc2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C16H16O3.C15H14O3/c1-12-10-14(8-9-15(12)16(17)18-2)19-11-13-6-4-3-5-7-13;1-11-9-13(7-8-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h3-10H,11H2,1-2H3;2-9H,10H2,1H3,(H,16,17) |
| InChIKey | LARDEBYTNDJBGN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |