C28H34O4 — CID 158505754
butan-2-ylbenzene;4-[(4-butan-2-ylphenyl)methoxy]-2-hydroxybenzoic acid (PubChem CID 158505754) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is butan-2-ylbenzene;4-[(4-butan-2-ylphenyl)methoxy]-2-hydroxybenzoic acid.
| Compound Name | butan-2-ylbenzene;4-[(4-butan-2-ylphenyl)methoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 158505754 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | butan-2-ylbenzene;4-[(4-butan-2-ylphenyl)methoxy]-2-hydroxybenzoic acid |
| SMILES | CCC(C)c1ccc(COc2ccc(C(=O)O)c(O)c2)cc1.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C18H20O4.C10H14/c1-3-12(2)14-6-4-13(5-7-14)11-22-15-8-9-16(18(20)21)17(19)10-15;1-3-9(2)10-7-5-4-6-8-10/h4-10,12,19H,3,11H2,1-2H3,(H,20,21);4-9H,3H2,1-2H3 |
| InChIKey | HKLGITWAIZELAU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |