C18H20O5 — CID 19857055
2-hydroxy-4-[2-(4-propan-2-ylphenoxy)ethoxy]benzoic acid (PubChem CID 19857055) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-hydroxy-4-[2-(4-propan-2-ylphenoxy)ethoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[2-(4-propan-2-ylphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 19857055 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-hydroxy-4-[2-(4-propan-2-ylphenoxy)ethoxy]benzoic acid |
| SMILES | CC(C)c1ccc(OCCOc2ccc(C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H20O5/c1-12(2)13-3-5-14(6-4-13)22-9-10-23-15-7-8-16(18(20)21)17(19)11-15/h3-8,11-12,19H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | GGUVLIHGVODWIV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|