C11H14O3 — CID 54169876
4-butan-2-yl-2-hydroxybenzoic acid (PubChem CID 54169876) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-butan-2-yl-2-hydroxybenzoic acid.
| Compound Name | 4-butan-2-yl-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54169876 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-butan-2-yl-2-hydroxybenzoic acid |
| SMILES | CCC(C)c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C11H14O3/c1-3-7(2)8-4-5-9(11(13)14)10(12)6-8/h4-7,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | WRIPSOPAYPBWOW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |