C22H26O8S — CID 70358840
2-butan-2-yl-3-(2-butan-2-yl-3-carboxy-6-hydroxyphenyl)sulfonyl-4-hydroxybenzoic acid (PubChem CID 70358840) has the molecular formula C22H26O8S and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-butan-2-yl-3-(2-butan-2-yl-3-carboxy-6-hydroxyphenyl)sulfonyl-4-hydroxybenzoic acid.
| Compound Name | 2-butan-2-yl-3-(2-butan-2-yl-3-carboxy-6-hydroxyphenyl)sulfonyl-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70358840 |
| Molecular Formula | C22H26O8S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-butan-2-yl-3-(2-butan-2-yl-3-carboxy-6-hydroxyphenyl)sulfonyl-4-hydroxybenzoic acid |
| SMILES | CCC(C)c1c(C(=O)O)ccc(O)c1S(=O)(=O)c1c(O)ccc(C(=O)O)c1C(C)CC |
| InChI | InChI=1S/C22H26O8S/c1-5-11(3)17-13(21(25)26)7-9-15(23)19(17)31(29,30)20-16(24)10-8-14(22(27)28)18(20)12(4)6-2/h7-12,23-24H,5-6H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | QMTYJHAPQHMIRT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |