C34H34O8S — CID 70358904
3-[3-carboxy-6-hydroxy-2-(4-phenylbutyl)phenyl]sulfonyl-4-hydroxy-2-(4-phenylbutyl)benzoic acid (PubChem CID 70358904) has the molecular formula C34H34O8S and a molecular weight of 602.71 g/mol. Its IUPAC name is 3-[3-carboxy-6-hydroxy-2-(4-phenylbutyl)phenyl]sulfonyl-4-hydroxy-2-(4-phenylbutyl)benzoic acid.
| Compound Name | 3-[3-carboxy-6-hydroxy-2-(4-phenylbutyl)phenyl]sulfonyl-4-hydroxy-2-(4-phenylbutyl)benzoic acid |
|---|---|
| PubChem CID | 70358904 |
| Molecular Formula | C34H34O8S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 3-[3-carboxy-6-hydroxy-2-(4-phenylbutyl)phenyl]sulfonyl-4-hydroxy-2-(4-phenylbutyl)benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(S(=O)(=O)c2c(O)ccc(C(=O)O)c2CCCCc2ccccc2)c1CCCCc1ccccc1 |
| InChI | InChI=1S/C34H34O8S/c35-29-21-19-27(33(37)38)25(17-9-7-15-23-11-3-1-4-12-23)31(29)43(41,42)32-26(28(34(39)40)20-22-30(32)36)18-10-8-16-24-13-5-2-6-14-24/h1-6,11-14,19-22,35-36H,7-10,15-18H2,(H,37,38)(H,39,40) |
| InChIKey | BRDJJKCLMJWFDK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|