C19H18FNO2 — CID 67711004
4-cyano-3-fluoro-2-(5-phenylpentyl)benzoic acid (PubChem CID 67711004) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-cyano-3-fluoro-2-(5-phenylpentyl)benzoic acid.
| Compound Name | 4-cyano-3-fluoro-2-(5-phenylpentyl)benzoic acid |
|---|---|
| PubChem CID | 67711004 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-cyano-3-fluoro-2-(5-phenylpentyl)benzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)c(CCCCCc2ccccc2)c1F |
| InChI | InChI=1S/C19H18FNO2/c20-18-15(13-21)11-12-17(19(22)23)16(18)10-6-2-5-9-14-7-3-1-4-8-14/h1,3-4,7-8,11-12H,2,5-6,9-10H2,(H,22,23) |
| InChIKey | GAGVVMFICUHSGM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|