3-butan-2-yl-4-nonylphthalic acid

C21H32O4 — CID 69471256

IUPAC3-butan-2-yl-4-nonylphthalic acid
SMILESCCCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1C(C)CC
InChIInChI=1S/C21H32O4/c1-4-6-7-8-9-10-11-12-16-13-14-17(20(22)23)19(21(24)25)18(16)15(3)5-2/h13-15H,4-12H2,1-3H3,(H,22,23)(H,24,25)
InChIKeyFVOFVXMBMDRRBG-UHFFFAOYSA-N
MW348.48 g/mol
LogP5.89
Rot. Bonds12

About 3-butan-2-yl-4-nonylphthalic acid

3-butan-2-yl-4-nonylphthalic acid (PubChem CID 69471256) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-butan-2-yl-4-nonylphthalic acid.

Molecular Properties

Compound Name3-butan-2-yl-4-nonylphthalic acid
PubChem CID69471256
Molecular FormulaC21H32O4
Molecular Weight348.48 g/mol
Exact Mass348.23
IUPAC Name3-butan-2-yl-4-nonylphthalic acid
SMILESCCCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1C(C)CC
InChIInChI=1S/C21H32O4/c1-4-6-7-8-9-10-11-12-16-13-14-17(20(22)23)19(21(24)25)18(16)15(3)5-2/h13-15H,4-12H2,1-3H3,(H,22,23)(H,24,25)
InChIKeyFVOFVXMBMDRRBG-UHFFFAOYSA-N
XLogP5.89
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500348.48
LogP ≤ 55.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-butan-2-yl-4-nonylphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-butan-2-yl-4-tridecylphthalic acid
CID 69471715
3-butan-2-yl-4-octylphthalic acid
CID 69473429
3-propan-2-yl-4-tetradecylphthalic acid
CID 69477838
4-heptadecyl-3-methylphthalic acid
CID 69470655
3-nonyl-4-octylphthalic acid
CID 54095595
3-(2-methylpropyl)-4-undecylphthalic acid
CID 69470722
4-butan-2-yl-3-heptylphthalic acid
CID 69471939
4-decyl-3-(2-methylpropyl)phthalic acid
CID 69472278
bis(3,4-dibutylphthalic acid);3,4-di(nonyl)phthalic acid
CID 87150790
3-chloro-4-pentylphthalic acid
CID 175092843
4-ethyl-3-pentadecylphthalic acid
CID 69473605
4-propyl-3-undecylphthalic acid
CID 69473575

Frequently Asked Questions

What is the IUPAC name of 3-butan-2-yl-4-nonylphthalic acid?
The IUPAC name of 3-butan-2-yl-4-nonylphthalic acid (CID 69471256) is 3-butan-2-yl-4-nonylphthalic acid.
What is the SMILES notation for 3-butan-2-yl-4-nonylphthalic acid?
The canonical SMILES for 3-butan-2-yl-4-nonylphthalic acid is CCCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1C(C)CC.
What is the InChIKey of 3-butan-2-yl-4-nonylphthalic acid?
The InChIKey is FVOFVXMBMDRRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O4/c1-4-6-7-8-9-10-11-12-16-13-14-17(20(22)23)19(21(24)25)18(16)15(3)5-2/h13-15H,4-12H2,1-3H3,(H,22,23)(H,24,25).
What are the key properties of 3-butan-2-yl-4-nonylphthalic acid?
3-butan-2-yl-4-nonylphthalic acid has a molecular weight of 348.48 g/mol, XLogP of 5.89, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-4-nonylphthalic acid is sourced from PubChem (CID 69471256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).