C10H14ClNO3 — CID 23617210
2-chloro-4,5-dimethylphenol;methyl carbamate (PubChem CID 23617210) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 2-chloro-4,5-dimethylphenol;methyl carbamate.
| Compound Name | 2-chloro-4,5-dimethylphenol;methyl carbamate |
|---|---|
| PubChem CID | 23617210 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-chloro-4,5-dimethylphenol;methyl carbamate |
| SMILES | COC(N)=O.Cc1cc(O)c(Cl)cc1C |
| InChI | InChI=1S/C8H9ClO.C2H5NO2/c1-5-3-7(9)8(10)4-6(5)2;1-5-2(3)4/h3-4,10H,1-2H3;1H3,(H2,3,4) |
| InChIKey | ZIWAXKRVDLIKKK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |