C8H7Cl2NO2 — CID 175535955
(2,5-dichloro-4-methylphenyl) carbamate (PubChem CID 175535955) has the molecular formula C8H7Cl2NO2 and a molecular weight of 220.06 g/mol. Its IUPAC name is (2,5-dichloro-4-methylphenyl) carbamate.
| Compound Name | (2,5-dichloro-4-methylphenyl) carbamate |
|---|---|
| PubChem CID | 175535955 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (2,5-dichloro-4-methylphenyl) carbamate |
| SMILES | Cc1cc(Cl)c(OC(N)=O)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO2/c1-4-2-6(10)7(3-5(4)9)13-8(11)12/h2-3H,1H3,(H2,11,12) |
| InChIKey | UZJZOXQCPPILTQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |