C8H10ClNO — CID 117273114
O-(4-chloro-2,5-dimethylphenyl)hydroxylamine (PubChem CID 117273114) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is O-(4-chloro-2,5-dimethylphenyl)hydroxylamine.
| Compound Name | O-(4-chloro-2,5-dimethylphenyl)hydroxylamine |
|---|---|
| PubChem CID | 117273114 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | O-(4-chloro-2,5-dimethylphenyl)hydroxylamine |
| SMILES | Cc1cc(ON)c(C)cc1Cl |
| InChI | InChI=1S/C8H10ClNO/c1-5-4-8(11-10)6(2)3-7(5)9/h3-4H,10H2,1-2H3 |
| InChIKey | NTGAKGBXFCKBFT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|