C9H11ClO — CID 18683267
1-chloro-5-methoxy-2,4-dimethylbenzene (PubChem CID 18683267) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is 1-chloro-5-methoxy-2,4-dimethylbenzene.
| Compound Name | 1-chloro-5-methoxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 18683267 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-chloro-5-methoxy-2,4-dimethylbenzene |
| SMILES | COc1cc(Cl)c(C)cc1C |
| InChI | InChI=1S/C9H11ClO/c1-6-4-7(2)9(11-3)5-8(6)10/h4-5H,1-3H3 |
| InChIKey | VRARKRQZBRXHKJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |