C10H16Cl2O2 — CID 172845974
1,4-dimethoxy-2,5-dimethylbenzene;dihydrochloride (PubChem CID 172845974) has the molecular formula C10H16Cl2O2 and a molecular weight of 239.14 g/mol. Its IUPAC name is 1,4-dimethoxy-2,5-dimethylbenzene;dihydrochloride.
| Compound Name | 1,4-dimethoxy-2,5-dimethylbenzene;dihydrochloride |
|---|---|
| PubChem CID | 172845974 |
| Molecular Formula | C10H16Cl2O2 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1,4-dimethoxy-2,5-dimethylbenzene;dihydrochloride |
| SMILES | COc1cc(C)c(OC)cc1C.Cl.Cl |
| InChI | InChI=1S/C10H14O2.2ClH/c1-7-5-10(12-4)8(2)6-9(7)11-3;;/h5-6H,1-4H3;2*1H |
| InChIKey | XKRQETFNULLYPZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |