C10H14O2S — CID 117035950
1-methoxy-4-methoxysulfanyl-2,5-dimethylbenzene (PubChem CID 117035950) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-methoxy-4-methoxysulfanyl-2,5-dimethylbenzene.
| Compound Name | 1-methoxy-4-methoxysulfanyl-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 117035950 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-methoxy-4-methoxysulfanyl-2,5-dimethylbenzene |
| SMILES | COSc1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C10H14O2S/c1-7-6-10(13-12-4)8(2)5-9(7)11-3/h5-6H,1-4H3 |
| InChIKey | HKVYTGNCPVBIQB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|