C12H17NOS — CID 117032983
3-(4-methoxy-2,5-dimethylphenyl)sulfanylazetidine (PubChem CID 117032983) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-(4-methoxy-2,5-dimethylphenyl)sulfanylazetidine.
| Compound Name | 3-(4-methoxy-2,5-dimethylphenyl)sulfanylazetidine |
|---|---|
| PubChem CID | 117032983 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(4-methoxy-2,5-dimethylphenyl)sulfanylazetidine |
| SMILES | COc1cc(C)c(SC2CNC2)cc1C |
| InChI | InChI=1S/C12H17NOS/c1-8-5-12(15-10-6-13-7-10)9(2)4-11(8)14-3/h4-5,10,13H,6-7H2,1-3H3 |
| InChIKey | KNFXKIZAJBWYCK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |