C13H19NO2 — CID 82286623
3-[(2,5-dimethoxy-4-methylphenyl)methyl]azetidine (PubChem CID 82286623) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(2,5-dimethoxy-4-methylphenyl)methyl]azetidine.
| Compound Name | 3-[(2,5-dimethoxy-4-methylphenyl)methyl]azetidine |
|---|---|
| PubChem CID | 82286623 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[(2,5-dimethoxy-4-methylphenyl)methyl]azetidine |
| SMILES | COc1cc(CC2CNC2)c(OC)cc1C |
| InChI | InChI=1S/C13H19NO2/c1-9-4-13(16-3)11(6-12(9)15-2)5-10-7-14-8-10/h4,6,10,14H,5,7-8H2,1-3H3 |
| InChIKey | LXZRBIUXMFSKAN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |