C13H20N2O — CID 115207226
N-(azetidin-3-ylmethyl)-2-methoxy-4,5-dimethylaniline (PubChem CID 115207226) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-2-methoxy-4,5-dimethylaniline.
| Compound Name | N-(azetidin-3-ylmethyl)-2-methoxy-4,5-dimethylaniline |
|---|---|
| PubChem CID | 115207226 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-2-methoxy-4,5-dimethylaniline |
| SMILES | COc1cc(C)c(C)cc1NCC1CNC1 |
| InChI | InChI=1S/C13H20N2O/c1-9-4-12(13(16-3)5-10(9)2)15-8-11-6-14-7-11/h4-5,11,14-15H,6-8H2,1-3H3 |
| InChIKey | OFQOTHBOPHJLCY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |