C14H22N2O3 — CID 115237476
2,5-dimethoxy-4-methyl-N-(morpholin-2-ylmethyl)aniline (PubChem CID 115237476) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,5-dimethoxy-4-methyl-N-(morpholin-2-ylmethyl)aniline.
| Compound Name | 2,5-dimethoxy-4-methyl-N-(morpholin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 115237476 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2,5-dimethoxy-4-methyl-N-(morpholin-2-ylmethyl)aniline |
| SMILES | COc1cc(NCC2CNCCO2)c(OC)cc1C |
| InChI | InChI=1S/C14H22N2O3/c1-10-6-14(18-3)12(7-13(10)17-2)16-9-11-8-15-4-5-19-11/h6-7,11,15-16H,4-5,8-9H2,1-3H3 |
| InChIKey | OFKRBWPUJSRBGE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |