C10H15NO2S — CID 115227630
(2,5-dimethoxy-4-methylanilino)methanethiol (PubChem CID 115227630) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (2,5-dimethoxy-4-methylanilino)methanethiol.
| Compound Name | (2,5-dimethoxy-4-methylanilino)methanethiol |
|---|---|
| PubChem CID | 115227630 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2,5-dimethoxy-4-methylanilino)methanethiol |
| SMILES | COc1cc(NCS)c(OC)cc1C |
| InChI | InChI=1S/C10H15NO2S/c1-7-4-10(13-3)8(11-6-14)5-9(7)12-2/h4-5,11,14H,6H2,1-3H3 |
| InChIKey | DGLAVUVTXBSTHC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|