C13H20N2O2S — CID 115207328
N-(azetidin-3-ylmethyl)-2,5-dimethoxy-4-methylsulfanylaniline (PubChem CID 115207328) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-2,5-dimethoxy-4-methylsulfanylaniline.
| Compound Name | N-(azetidin-3-ylmethyl)-2,5-dimethoxy-4-methylsulfanylaniline |
|---|---|
| PubChem CID | 115207328 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-2,5-dimethoxy-4-methylsulfanylaniline |
| SMILES | COc1cc(SC)c(OC)cc1NCC1CNC1 |
| InChI | InChI=1S/C13H20N2O2S/c1-16-11-5-13(18-3)12(17-2)4-10(11)15-8-9-6-14-7-9/h4-5,9,14-15H,6-8H2,1-3H3 |
| InChIKey | LBLXQNQUOFHXLF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |