C10H16N2O2S — CID 115225488
N'-(2,5-dimethoxy-4-methylsulfanylphenyl)methanediamine (PubChem CID 115225488) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is N'-(2,5-dimethoxy-4-methylsulfanylphenyl)methanediamine.
| Compound Name | N'-(2,5-dimethoxy-4-methylsulfanylphenyl)methanediamine |
|---|---|
| PubChem CID | 115225488 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N'-(2,5-dimethoxy-4-methylsulfanylphenyl)methanediamine |
| SMILES | COc1cc(SC)c(OC)cc1NCN |
| InChI | InChI=1S/C10H16N2O2S/c1-13-8-5-10(15-3)9(14-2)4-7(8)12-6-11/h4-5,12H,6,11H2,1-3H3 |
| InChIKey | SCAMWUYVUOSYIH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|