C11H17NO3S — CID 117360537
2-amino-1-(2,5-dimethoxy-4-methylsulfanylphenyl)ethanol (PubChem CID 117360537) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-amino-1-(2,5-dimethoxy-4-methylsulfanylphenyl)ethanol.
| Compound Name | 2-amino-1-(2,5-dimethoxy-4-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 117360537 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-amino-1-(2,5-dimethoxy-4-methylsulfanylphenyl)ethanol |
| SMILES | COc1cc(C(O)CN)c(OC)cc1SC |
| InChI | InChI=1S/C11H17NO3S/c1-14-9-5-11(16-3)10(15-2)4-7(9)8(13)6-12/h4-5,8,13H,6,12H2,1-3H3 |
| InChIKey | KFOJLZRLKLCOLM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |