C10H14O2S2 — CID 2802745
1,4-dimethoxy-2,5-bis(methylsulfanyl)benzene (PubChem CID 2802745) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,4-dimethoxy-2,5-bis(methylsulfanyl)benzene.
| Compound Name | 1,4-dimethoxy-2,5-bis(methylsulfanyl)benzene |
|---|---|
| PubChem CID | 2802745 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 1,4-dimethoxy-2,5-bis(methylsulfanyl)benzene |
| SMILES | COc1cc(SC)c(OC)cc1SC |
| InChI | InChI=1S/C10H14O2S2/c1-11-7-5-10(14-4)8(12-2)6-9(7)13-3/h5-6H,1-4H3 |
| InChIKey | CJXKRKDHVGYORB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |