C12H15NO2S — CID 116927396
3-(2,5-dimethoxy-4-methylsulfanylphenyl)propanenitrile (PubChem CID 116927396) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-4-methylsulfanylphenyl)propanenitrile.
| Compound Name | 3-(2,5-dimethoxy-4-methylsulfanylphenyl)propanenitrile |
|---|---|
| PubChem CID | 116927396 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-(2,5-dimethoxy-4-methylsulfanylphenyl)propanenitrile |
| SMILES | COc1cc(SC)c(OC)cc1CCC#N |
| InChI | InChI=1S/C12H15NO2S/c1-14-10-8-12(16-3)11(15-2)7-9(10)5-4-6-13/h7-8H,4-5H2,1-3H3 |
| InChIKey | PUIGDZATAGGOPJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |