C13H19NO3S — CID 86043168
N-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]acetamide (PubChem CID 86043168) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]acetamide.
| Compound Name | N-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 86043168 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]acetamide |
| SMILES | COc1cc(SC)c(OC)cc1CCNC(C)=O |
| InChI | InChI=1S/C13H19NO3S/c1-9(15)14-6-5-10-7-12(17-3)13(18-4)8-11(10)16-2/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | IXIKVQQQZVKSLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |