C17H20F7NO3S — CID 165362004
N-[2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 165362004) has the molecular formula C17H20F7NO3S and a molecular weight of 451.40 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 165362004 |
| Molecular Formula | C17H20F7NO3S |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | COc1cc(SC(C)C)c(OC)cc1CCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H20F7NO3S/c1-9(2)29-13-8-11(27-3)10(7-12(13)28-4)5-6-25-14(26)15(18,19)16(20,21)17(22,23)24/h7-9H,5-6H2,1-4H3,(H,25,26) |
| InChIKey | MJZJFNYYTVPRAW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|