C22H24F4N2O4 — CID 2933838
2,2,3,3-tetrafluoro-N,N'-bis[2-(4-methoxyphenyl)ethyl]butanediamide (PubChem CID 2933838) has the molecular formula C22H24F4N2O4 and a molecular weight of 456.44 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis[2-(4-methoxyphenyl)ethyl]butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis[2-(4-methoxyphenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 2933838 |
| Molecular Formula | C22H24F4N2O4 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis[2-(4-methoxyphenyl)ethyl]butanediamide |
| SMILES | COc1ccc(CCNC(=O)C(F)(F)C(F)(F)C(=O)NCCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24F4N2O4/c1-31-17-7-3-15(4-8-17)11-13-27-19(29)21(23,24)22(25,26)20(30)28-14-12-16-5-9-18(32-2)10-6-16/h3-10H,11-14H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | IVAMJLKVBDUJPQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|