C26H26F3NO5 — CID 53465746
N-[2-[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 53465746) has the molecular formula C26H26F3NO5 and a molecular weight of 489.49 g/mol. Its IUPAC name is N-[2-[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 53465746 |
| Molecular Formula | C26H26F3NO5 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[2-[3,5-bis[(4-methoxyphenyl)methoxy]phenyl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(COc2cc(CCNC(=O)C(F)(F)F)cc(OCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C26H26F3NO5/c1-32-21-7-3-18(4-8-21)16-34-23-13-20(11-12-30-25(31)26(27,28)29)14-24(15-23)35-17-19-5-9-22(33-2)10-6-19/h3-10,13-15H,11-12,16-17H2,1-2H3,(H,30,31) |
| InChIKey | VMFMRQNWUWYKBC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |