C12H13F3N2O3 — CID 108537590
4-methoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide (PubChem CID 108537590) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108537590 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-methoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-20-9-4-2-8(3-5-9)10(18)16-6-7-17-11(19)12(13,14)15/h2-5H,6-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | JKTDOAWQMRDUQF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|