C18H17F3N2O5S — CID 55880093
4-methoxy-N-[2-[[4-(trifluoromethylsulfonyl)benzoyl]amino]ethyl]benzamide (PubChem CID 55880093) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[4-(trifluoromethylsulfonyl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[4-(trifluoromethylsulfonyl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55880093 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-methoxy-N-[2-[[4-(trifluoromethylsulfonyl)benzoyl]amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H17F3N2O5S/c1-28-14-6-2-12(3-7-14)16(24)22-10-11-23-17(25)13-4-8-15(9-5-13)29(26,27)18(19,20)21/h2-9H,10-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | RJMGUPSXRUTTGA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|