C12H10F6N2O2 — CID 108537709
N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 108537709) has the molecular formula C12H10F6N2O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108537709 |
| Molecular Formula | C12H10F6N2O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F6N2O2/c13-11(14,15)8-3-1-7(2-4-8)9(21)19-5-6-20-10(22)12(16,17)18/h1-4H,5-6H2,(H,19,21)(H,20,22) |
| InChIKey | BIIICSHFGPEDGM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|