C16H19F3N2O3 — CID 110907156
N-[2-[(1-hydroxycyclopentanecarbonyl)amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 110907156) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[2-[(1-hydroxycyclopentanecarbonyl)amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(1-hydroxycyclopentanecarbonyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 110907156 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-[(1-hydroxycyclopentanecarbonyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNC(=O)C1(O)CCCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O3/c17-16(18,19)12-5-3-11(4-6-12)13(22)20-9-10-21-14(23)15(24)7-1-2-8-15/h3-6,24H,1-2,7-10H2,(H,20,22)(H,21,23) |
| InChIKey | JHBAICBDIVDIPK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|