C10H12F3N3O3S — CID 75402734
N-[2-(sulfamoylamino)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 75402734) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is N-[2-(sulfamoylamino)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(sulfamoylamino)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 75402734 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-[2-(sulfamoylamino)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | NS(=O)(=O)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3N3O3S/c11-10(12,13)8-3-1-7(2-4-8)9(17)15-5-6-16-20(14,18)19/h1-4,16H,5-6H2,(H,15,17)(H2,14,18,19) |
| InChIKey | YUBLBGHUYUPDLK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|