C14H18F3N3O5S — CID 18723380
N-[2-[[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]sulfonylamino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 18723380) has the molecular formula C14H18F3N3O5S and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[2-[[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]sulfonylamino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]sulfonylamino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18723380 |
| Molecular Formula | C14H18F3N3O5S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[2-[[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]sulfonylamino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C(=O)NO)S(=O)(=O)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3N3O5S/c1-13(2,12(22)20-23)26(24,25)19-8-7-18-11(21)9-3-5-10(6-4-9)14(15,16)17/h3-6,19,23H,7-8H2,1-2H3,(H,18,21)(H,20,22) |
| InChIKey | ZDHOAKGSWUCIQM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|