C20H19F3N2O3 — CID 113061679
N-[2-(N,4-diacetylanilino)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 113061679) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[2-(N,4-diacetylanilino)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(N,4-diacetylanilino)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113061679 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-(N,4-diacetylanilino)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(=O)c1ccc(N(CCNC(=O)c2ccc(C(F)(F)F)cc2)C(C)=O)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-13(26)15-5-9-18(10-6-15)25(14(2)27)12-11-24-19(28)16-3-7-17(8-4-16)20(21,22)23/h3-10H,11-12H2,1-2H3,(H,24,28) |
| InChIKey | DUYJTXRWFHHHEZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |